C21H23ClN4O3 — CID 70946730
N-(3-chloro-4-methylphenyl)-6-methoxy-7-(morpholin-2-ylmethoxy)quinazolin-4-amine (PubChem CID 70946730) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-6-methoxy-7-(morpholin-2-ylmethoxy)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-methylphenyl)-6-methoxy-7-(morpholin-2-ylmethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 70946730 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-6-methoxy-7-(morpholin-2-ylmethoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(C)c(Cl)c3)ncnc2cc1OCC1CNCCO1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-13-3-4-14(7-17(13)22)26-21-16-8-19(27-2)20(9-18(16)24-12-25-21)29-11-15-10-23-5-6-28-15/h3-4,7-9,12,15,23H,5-6,10-11H2,1-2H3,(H,24,25,26) |
| InChIKey | JEOWLIZJAIVOKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |