C20H16Cl2N2O4 — CID 70946839
2,3-dichloro-6,13-diethyl-9,10-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 70946839) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is 2,3-dichloro-6,13-diethyl-9,10-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,3-dichloro-6,13-diethyl-9,10-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 70946839 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 2,3-dichloro-6,13-diethyl-9,10-dimethyl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | CCN1C(=O)c2c(C)c(C)c3c4c(c(Cl)c(Cl)c(c24)C1=O)C(=O)N(CC)C3=O |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-5-23-17(25)9-7(3)8(4)10-12-11(9)13(19(23)27)15(21)16(22)14(12)20(28)24(6-2)18(10)26/h5-6H2,1-4H3 |
| InChIKey | JITHKAJFZUGSGB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|