C23H19N3O3S2 — CID 70947087
3-[2-(4-methylsulfonylanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol (PubChem CID 70947087) has the molecular formula C23H19N3O3S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 3-[2-(4-methylsulfonylanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol.
| Compound Name | 3-[2-(4-methylsulfonylanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol |
|---|---|
| PubChem CID | 70947087 |
| Molecular Formula | C23H19N3O3S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 3-[2-(4-methylsulfonylanilino)-5,6-dihydrothieno[2,3-h]quinazolin-8-yl]phenol |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncc3c(n2)-c2cc(-c4cccc(O)c4)sc2CC3)cc1 |
| InChI | InChI=1S/C23H19N3O3S2/c1-31(28,29)18-8-6-16(7-9-18)25-23-24-13-15-5-10-20-19(22(15)26-23)12-21(30-20)14-3-2-4-17(27)11-14/h2-4,6-9,11-13,27H,5,10H2,1H3,(H,24,25,26) |
| InChIKey | PTQBXIDSEFJPIU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |