C10H21BO3 — CID 70947330
2-butan-2-yloxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70947330) has the molecular formula C10H21BO3 and a molecular weight of 200.09 g/mol. Its IUPAC name is 2-butan-2-yloxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-butan-2-yloxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70947330 |
| Molecular Formula | C10H21BO3 |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-butan-2-yloxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC(C)OB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H21BO3/c1-7-8(2)12-11-13-9(3,4)10(5,6)14-11/h8H,7H2,1-6H3 |
| InChIKey | KUSHQPGQRPDZNC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|