C12H20BNO2 — CID 70948072
(1R)-1-[(1S,2S,3R,7R)-3,7-dimethyl-8,10-dioxa-9-boratetracyclo[5.3.0.02,4.03,5]decan-9-yl]propan-1-amine (PubChem CID 70948072) has the molecular formula C12H20BNO2 and a molecular weight of 221.11 g/mol. Its IUPAC name is (1R)-1-[(1S,2S,3R,7R)-3,7-dimethyl-8,10-dioxa-9-boratetracyclo[5.3.0.02,4.03,5]decan-9-yl]propan-1-amine.
| Compound Name | (1R)-1-[(1S,2S,3R,7R)-3,7-dimethyl-8,10-dioxa-9-boratetracyclo[5.3.0.02,4.03,5]decan-9-yl]propan-1-amine |
|---|---|
| PubChem CID | 70948072 |
| Molecular Formula | C12H20BNO2 |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (1R)-1-[(1S,2S,3R,7R)-3,7-dimethyl-8,10-dioxa-9-boratetracyclo[5.3.0.02,4.03,5]decan-9-yl]propan-1-amine |
| SMILES | CC[C@H](N)B1O[C@H]2[C@H]3C4C(C[C@@]2(C)O1)[C@]43C |
| InChI | InChI=1S/C12H20BNO2/c1-4-7(14)13-15-10-9-8-6(12(8,9)3)5-11(10,2)16-13/h6-10H,4-5,14H2,1-3H3/t6?,7-,8?,9+,10-,11+,12+/m0/s1 |
| InChIKey | IPNQMHWNSKIQFL-IUACRHLJSA-N |
| XLogP | 1.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|