C18H19F3N2OS — CID 70948420
2-[2-ethoxyethyl(methyl)amino]-5-methyl-4-[3-(trifluoromethyl)phenyl]thiophene-3-carbonitrile (PubChem CID 70948420) has the molecular formula C18H19F3N2OS and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[2-ethoxyethyl(methyl)amino]-5-methyl-4-[3-(trifluoromethyl)phenyl]thiophene-3-carbonitrile.
| Compound Name | 2-[2-ethoxyethyl(methyl)amino]-5-methyl-4-[3-(trifluoromethyl)phenyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 70948420 |
| Molecular Formula | C18H19F3N2OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[2-ethoxyethyl(methyl)amino]-5-methyl-4-[3-(trifluoromethyl)phenyl]thiophene-3-carbonitrile |
| SMILES | CCOCCN(C)c1sc(C)c(-c2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C18H19F3N2OS/c1-4-24-9-8-23(3)17-15(11-22)16(12(2)25-17)13-6-5-7-14(10-13)18(19,20)21/h5-7,10H,4,8-9H2,1-3H3 |
| InChIKey | MQUWRVKMFAIKHW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|