About 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole
1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole (PubChem CID 70949255) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole.
Molecular Properties
| Compound Name | 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole |
| PubChem CID | 70949255 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole |
| SMILES | Cc1ccn(CCCC2C=CC=CC2)n1 |
| InChI | InChI=1S/C13H18N2/c1-12-9-11-15(14-12)10-5-8-13-6-3-2-4-7-13/h2-4,6,9,11,13H,5,7-8,10H2,1H3 |
| InChIKey | GCXWOTYWACYBIR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole?
The IUPAC name of 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole (CID 70949255) is 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole.
What is the SMILES notation for 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole?
The canonical SMILES for 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole is Cc1ccn(CCCC2C=CC=CC2)n1.
What is the InChIKey of 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole?
The InChIKey is GCXWOTYWACYBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-12-9-11-15(14-12)10-5-8-13-6-3-2-4-7-13/h2-4,6,9,11,13H,5,7-8,10H2,1H3.
What are the key properties of 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole?
1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole has a molecular weight of 202.30 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyclohexa-2,4-dien-1-ylpropyl)-3-methylpyrazole is sourced from PubChem (CID 70949255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).