C24H27N3O4S — CID 70950341
2-[(4R)-4-(4-methoxy-3-phenylmethoxyphenyl)-2-oxopyrrolidin-1-yl]-N-(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)acetamide (PubChem CID 70950341) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-[(4R)-4-(4-methoxy-3-phenylmethoxyphenyl)-2-oxopyrrolidin-1-yl]-N-(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)acetamide.
| Compound Name | 2-[(4R)-4-(4-methoxy-3-phenylmethoxyphenyl)-2-oxopyrrolidin-1-yl]-N-(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 70950341 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[(4R)-4-(4-methoxy-3-phenylmethoxyphenyl)-2-oxopyrrolidin-1-yl]-N-(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)acetamide |
| SMILES | COc1ccc([C@H]2CC(=O)N(CC(=O)NC3CC(C)=NS3)C2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-16-10-23(32-26-16)25-22(28)14-27-13-19(12-24(27)29)18-8-9-20(30-2)21(11-18)31-15-17-6-4-3-5-7-17/h3-9,11,19,23H,10,12-15H2,1-2H3,(H,25,28)/t19-,23?/m0/s1 |
| InChIKey | HVRZSYPCBMLDIK-HSTJUUNISA-N |
| XLogP | 3.55 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|