C12H23NO2S — CID 70950391
N,N-dicyclopentylethanesulfonamide (PubChem CID 70950391) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is N,N-dicyclopentylethanesulfonamide.
| Compound Name | N,N-dicyclopentylethanesulfonamide |
|---|---|
| PubChem CID | 70950391 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N,N-dicyclopentylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C12H23NO2S/c1-2-16(14,15)13(11-7-3-4-8-11)12-9-5-6-10-12/h11-12H,2-10H2,1H3 |
| InChIKey | XEIQUQLFYRUZPJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |