C26H30Cl2FN3O — CID 70951193
N-[(1S)-7a-(3-fluoropropoxy)-1,2,3,3a-tetrahydroinden-1-yl]-5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine (PubChem CID 70951193) has the molecular formula C26H30Cl2FN3O and a molecular weight of 490.45 g/mol. Its IUPAC name is N-[(1S)-7a-(3-fluoropropoxy)-1,2,3,3a-tetrahydroinden-1-yl]-5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine.
| Compound Name | N-[(1S)-7a-(3-fluoropropoxy)-1,2,3,3a-tetrahydroinden-1-yl]-5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine |
|---|---|
| PubChem CID | 70951193 |
| Molecular Formula | C26H30Cl2FN3O |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[(1S)-7a-(3-fluoropropoxy)-1,2,3,3a-tetrahydroinden-1-yl]-5-(2,4-dichlorophenyl)-3,6-diethylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(Cl)cc2Cl)c(CC)nc1N[C@H]1CCC2C=CC=CC21OCCCF |
| InChI | InChI=1S/C26H30Cl2FN3O/c1-3-21-24(19-11-10-18(27)16-20(19)28)30-22(4-2)25(31-21)32-23-12-9-17-8-5-6-13-26(17,23)33-15-7-14-29/h5-6,8,10-11,13,16-17,23H,3-4,7,9,12,14-15H2,1-2H3,(H,31,32)/t17?,23-,26?/m0/s1 |
| InChIKey | MSYJDGZIKDKONX-SPYQMNCUSA-N |
| XLogP | 7.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|