C28H27ClFN7O2 — CID 70951266
3-[[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-6-methylphenyl]methyl]phenol (PubChem CID 70951266) has the molecular formula C28H27ClFN7O2 and a molecular weight of 548.02 g/mol. Its IUPAC name is 3-[[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-6-methylphenyl]methyl]phenol.
| Compound Name | 3-[[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-6-methylphenyl]methyl]phenol |
|---|---|
| PubChem CID | 70951266 |
| Molecular Formula | C28H27ClFN7O2 |
| Molecular Weight | 548.02 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 3-[[2-chloro-4-[[6-[(Z)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]-6-methylphenyl]methyl]phenol |
| SMILES | Cc1cc(Nc2ccc(/C=N\Nc3ncc(F)c(N4CCOCC4)n3)nc2)cc(Cl)c1Cc1cccc(O)c1 |
| InChI | InChI=1S/C28H27ClFN7O2/c1-18-11-22(14-25(29)24(18)13-19-3-2-4-23(38)12-19)34-21-6-5-20(31-15-21)16-33-36-28-32-17-26(30)27(35-28)37-7-9-39-10-8-37/h2-6,11-12,14-17,34,38H,7-10,13H2,1H3,(H,32,35,36)/b33-16- |
| InChIKey | JGDSCFIFFBEQPU-BJUCDSOZSA-N |
| XLogP | 5.30 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.02 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|