C11H13I2N3O2 — CID 70951645
3-(3-tert-butyl-1,2-oxazol-5-yl)-5-(1,1-diiodoethyl)-1,2,4-oxadiazole (PubChem CID 70951645) has the molecular formula C11H13I2N3O2 and a molecular weight of 473.05 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2-oxazol-5-yl)-5-(1,1-diiodoethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-tert-butyl-1,2-oxazol-5-yl)-5-(1,1-diiodoethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 70951645 |
| Molecular Formula | C11H13I2N3O2 |
| Molecular Weight | 473.05 g/mol |
| Exact Mass | 472.91 |
| IUPAC Name | 3-(3-tert-butyl-1,2-oxazol-5-yl)-5-(1,1-diiodoethyl)-1,2,4-oxadiazole |
| SMILES | CC(C)(C)c1cc(-c2noc(C(C)(I)I)n2)on1 |
| InChI | InChI=1S/C11H13I2N3O2/c1-10(2,3)7-5-6(17-15-7)8-14-9(18-16-8)11(4,12)13/h5H,1-4H3 |
| InChIKey | CVEMDXSQBLRZAP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|