C11H14I2N4O — CID 70951686
3-tert-butyl-5-[5-(1,1-diiodoethyl)-1H-1,2,4-triazol-3-yl]-1,2-oxazole (PubChem CID 70951686) has the molecular formula C11H14I2N4O and a molecular weight of 472.07 g/mol. Its IUPAC name is 3-tert-butyl-5-[5-(1,1-diiodoethyl)-1H-1,2,4-triazol-3-yl]-1,2-oxazole.
| Compound Name | 3-tert-butyl-5-[5-(1,1-diiodoethyl)-1H-1,2,4-triazol-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 70951686 |
| Molecular Formula | C11H14I2N4O |
| Molecular Weight | 472.07 g/mol |
| Exact Mass | 471.93 |
| IUPAC Name | 3-tert-butyl-5-[5-(1,1-diiodoethyl)-1H-1,2,4-triazol-3-yl]-1,2-oxazole |
| SMILES | CC(C)(C)c1cc(-c2n[nH]c(C(C)(I)I)n2)on1 |
| InChI | InChI=1S/C11H14I2N4O/c1-10(2,3)7-5-6(18-17-7)8-14-9(16-15-8)11(4,12)13/h5H,1-4H3,(H,14,15,16) |
| InChIKey | UWULIWJAKBOKCA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.07 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|