C14H20O6 — CID 70952286
ethyl (3aS,4S,7aS)-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 70952286) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl (3aS,4S,7aS)-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7aS)-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 70952286 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl (3aS,4S,7aS)-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(OC(C)=O)C=CC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H20O6/c1-5-17-12(16)14(18-9(2)15)8-6-7-10-11(14)20-13(3,4)19-10/h6,8,10-11H,5,7H2,1-4H3/t10-,11-,14-/m0/s1 |
| InChIKey | HTFMGGRVGBNRRC-MJVIPROJSA-N |
| XLogP | 1.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|