C14H22O4 — CID 70952400
ethyl (3aR,7aS)-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 70952400) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl (3aR,7aS)-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,7aS)-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 70952400 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethyl (3aR,7aS)-2,2-diethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1C=CC[C@@H]2OC(CC)(CC)O[C@H]12 |
| InChI | InChI=1S/C14H22O4/c1-4-14(5-2)17-11-9-7-8-10(12(11)18-14)13(15)16-6-3/h7-8,10-12H,4-6,9H2,1-3H3/t10?,11-,12+/m0/s1 |
| InChIKey | WFXSPVAIFZEJIJ-GLXQMMQGSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|