C22H34N2O3 — CID 70952506
(4aS,8aS)-4-[1-[3-(cyclopropylmethoxymethylidene)cyclobutyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-3-one (PubChem CID 70952506) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is (4aS,8aS)-4-[1-[3-(cyclopropylmethoxymethylidene)cyclobutyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-3-one.
| Compound Name | (4aS,8aS)-4-[1-[3-(cyclopropylmethoxymethylidene)cyclobutyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 70952506 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (4aS,8aS)-4-[1-[3-(cyclopropylmethoxymethylidene)cyclobutyl]piperidin-4-yl]-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCCC[C@@H]2N1C1CCN(C2CC(=COCC3CC3)C2)CC1 |
| InChI | InChI=1S/C22H34N2O3/c25-22-15-27-21-4-2-1-3-20(21)24(22)18-7-9-23(10-8-18)19-11-17(12-19)14-26-13-16-5-6-16/h14,16,18-21H,1-13,15H2/b17-14-/t19?,20-,21-/m0/s1 |
| InChIKey | PUILUZXGIRIMLB-WOTCHTJMSA-N |
| XLogP | 3.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|