C19H35N3O2 — CID 70952810
3,3,5,5-tetramethyl-1-[2-(2,2,6,6-tetramethyl-3-oxopiperidin-4-yl)ethyl]piperazin-2-one (PubChem CID 70952810) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[2-(2,2,6,6-tetramethyl-3-oxopiperidin-4-yl)ethyl]piperazin-2-one.
| Compound Name | 3,3,5,5-tetramethyl-1-[2-(2,2,6,6-tetramethyl-3-oxopiperidin-4-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 70952810 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[2-(2,2,6,6-tetramethyl-3-oxopiperidin-4-yl)ethyl]piperazin-2-one |
| SMILES | CC1(C)CC(CCN2CC(C)(C)NC(C)(C)C2=O)C(=O)C(C)(C)N1 |
| InChI | InChI=1S/C19H35N3O2/c1-16(2)11-13(14(23)18(5,6)20-16)9-10-22-12-17(3,4)21-19(7,8)15(22)24/h13,20-21H,9-12H2,1-8H3 |
| InChIKey | OAIRRMYPDKQREH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |