About 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate
2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 70953303) has the molecular formula C20H29NO5S
and a molecular weight of 395.52 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate |
| PubChem CID | 70953303 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CC1C(O)CC(=O)[C@@H]1CCCc1ccc(C(=O)OCCN2CCOCC2)s1 |
| InChI | InChI=1S/C20H29NO5S/c1-14-16(18(23)13-17(14)22)4-2-3-15-5-6-19(27-15)20(24)26-12-9-21-7-10-25-11-8-21/h5-6,14,16-17,22H,2-4,7-13H2,1H3/t14?,16-,17?/m1/s1 |
| InChIKey | YNVXCTKWOYTGDC-ARWYELJZSA-N |
| XLogP | 2.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate (CID 70953303) is 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate is CC1C(O)CC(=O)[C@@H]1CCCc1ccc(C(=O)OCCN2CCOCC2)s1.
What is the InChIKey of 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate?
The InChIKey is YNVXCTKWOYTGDC-ARWYELJZSA-N. The full InChI is InChI=1S/C20H29NO5S/c1-14-16(18(23)13-17(14)22)4-2-3-15-5-6-19(27-15)20(24)26-12-9-21-7-10-25-11-8-21/h5-6,14,16-17,22H,2-4,7-13H2,1H3/t14?,16-,17?/m1/s1.
What are the key properties of 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate?
2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate has a molecular weight of 395.52 g/mol, XLogP of 2.15, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 5-[3-[(1R)-3-hydroxy-2-methyl-5-oxocyclopentyl]propyl]thiophene-2-carboxylate is sourced from PubChem (CID 70953303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).