C18H31N3O7 — CID 70953313
4-(2,5-dioxopyrrol-1-yl)-N-[3-[[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]propyl]butanamide (PubChem CID 70953313) has the molecular formula C18H31N3O7 and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-[3-[[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]propyl]butanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-[3-[[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]propyl]butanamide |
|---|---|
| PubChem CID | 70953313 |
| Molecular Formula | C18H31N3O7 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-[3-[[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]propyl]butanamide |
| SMILES | C[C@@H]([C@H](O)[C@@H](O)CNCCCNC(=O)CCCN1C(=O)C=CC1=O)[C@H](O)CO |
| InChI | InChI=1S/C18H31N3O7/c1-12(14(24)11-22)18(28)13(23)10-19-7-3-8-20-15(25)4-2-9-21-16(26)5-6-17(21)27/h5-6,12-14,18-19,22-24,28H,2-4,7-11H2,1H3,(H,20,25)/t12-,13+,14-,18+/m1/s1 |
| InChIKey | AAWSBWXEJFPCKM-NPSOMJIGSA-N |
| XLogP | -2.50 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|