C17H23NO3 — CID 70953477
4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-7,15(19)-diene (PubChem CID 70953477) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-7,15(19)-diene.
| Compound Name | 4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-7,15(19)-diene |
|---|---|
| PubChem CID | 70953477 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-7,15(19)-diene |
| SMILES | CN1CCC2=CCC3OCC4CC5=C(CC4C3C21)OCO5 |
| InChI | InChI=1S/C17H23NO3/c1-18-5-4-10-2-3-13-16(17(10)18)12-7-15-14(20-9-21-15)6-11(12)8-19-13/h2,11-13,16-17H,3-9H2,1H3 |
| InChIKey | ZQEVHJGOQQUDQR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|