About N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline
N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline (PubChem CID 70954044) has the molecular formula C19H19N
and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline.
Molecular Properties
| Compound Name | N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline |
| PubChem CID | 70954044 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline |
| SMILES | CC1(N(c2ccccc2)c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C19H19N/c1-19(15-9-4-10-16-19)20(17-11-5-2-6-12-17)18-13-7-3-8-14-18/h2-15H,16H2,1H3 |
| InChIKey | JIXMRHNALKJVCH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline?
The IUPAC name of N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline (CID 70954044) is N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline.
What is the SMILES notation for N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline?
The canonical SMILES for N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline is CC1(N(c2ccccc2)c2ccccc2)C=CC=CC1.
What is the InChIKey of N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline?
The InChIKey is JIXMRHNALKJVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N/c1-19(15-9-4-10-16-19)20(17-11-5-2-6-12-17)18-13-7-3-8-14-18/h2-15H,16H2,1H3.
What are the key properties of N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline?
N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline has a molecular weight of 261.37 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methylcyclohexa-2,4-dien-1-yl)-N-phenylaniline is sourced from PubChem (CID 70954044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).