C17H27NO3 — CID 70954224
2-ethyl-4-(3-methoxypropyl)-2,4a,6-trimethyl-8aH-1,4-benzoxazin-3-one (PubChem CID 70954224) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-ethyl-4-(3-methoxypropyl)-2,4a,6-trimethyl-8aH-1,4-benzoxazin-3-one.
| Compound Name | 2-ethyl-4-(3-methoxypropyl)-2,4a,6-trimethyl-8aH-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 70954224 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-ethyl-4-(3-methoxypropyl)-2,4a,6-trimethyl-8aH-1,4-benzoxazin-3-one |
| SMILES | CCC1(C)OC2C=CC(C)=CC2(C)N(CCCOC)C1=O |
| InChI | InChI=1S/C17H27NO3/c1-6-17(4)15(19)18(10-7-11-20-5)16(3)12-13(2)8-9-14(16)21-17/h8-9,12,14H,6-7,10-11H2,1-5H3 |
| InChIKey | YVZOESPLDJSXRF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|