C25H48O9Si — CID 70954318
dimethyl (2R,3R)-2,3-dihydroxy-2-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanedioate (PubChem CID 70954318) has the molecular formula C25H48O9Si and a molecular weight of 520.74 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-dihydroxy-2-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-dihydroxy-2-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanedioate |
|---|---|
| PubChem CID | 70954318 |
| Molecular Formula | C25H48O9Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | dimethyl (2R,3R)-2,3-dihydroxy-2-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]butanedioate |
| SMILES | COC(=O)[C@H](O)[C@](O)(C(=O)OC)[C@@H]1OC(C)(C)O[C@H]1[C@H](CC(C)CC(C)C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C25H48O9Si/c1-15(2)12-16(3)13-17(14-23(4,5)35(10,11)30)18-20(34-24(6,7)33-18)25(29,22(28)32-9)19(26)21(27)31-8/h15-20,26,29-30H,12-14H2,1-11H3/t16?,17-,18+,19+,20-,25-/m1/s1 |
| InChIKey | VXZRNLLTWPSYGJ-QSJCXKCLSA-N |
| XLogP | 3.00 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|