C15H24O6 — CID 70954421
ethyl (1R,3S,4S,5S,6R,7S)-6-ethoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 70954421) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is ethyl (1R,3S,4S,5S,6R,7S)-6-ethoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,3S,4S,5S,6R,7S)-6-ethoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 70954421 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | ethyl (1R,3S,4S,5S,6R,7S)-6-ethoxy-9,9-dimethyl-2,8,10-trioxatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@@H]3COC(C)(C)O[C@H]3[C@H](OCC)[C@H]21 |
| InChI | InChI=1S/C15H24O6/c1-5-17-13-9-10(14(16)18-6-2)12(9)20-8-7-19-15(3,4)21-11(8)13/h8-13H,5-7H2,1-4H3/t8-,9+,10+,11-,12+,13-/m1/s1 |
| InChIKey | IOWNJCXRMKOFDG-ZEPSMKPISA-N |
| XLogP | 1.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |