C26H33F3O5 — CID 70954434
7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-[8-(trifluoromethyl)naphthalen-2-yl]propyl]cyclopentyl]heptanoic acid (PubChem CID 70954434) has the molecular formula C26H33F3O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-[8-(trifluoromethyl)naphthalen-2-yl]propyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-[8-(trifluoromethyl)naphthalen-2-yl]propyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70954434 |
| Molecular Formula | C26H33F3O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-[8-(trifluoromethyl)naphthalen-2-yl]propyl]cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1C(CCC(O)c2ccc3cccc(C(F)(F)F)c3c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H33F3O5/c27-26(28,29)21-8-5-6-16-10-11-17(14-20(16)21)22(30)13-12-19-18(23(31)15-24(19)32)7-3-1-2-4-9-25(33)34/h5-6,8,10-11,14,18-19,22-24,30-32H,1-4,7,9,12-13,15H2,(H,33,34)/t18-,19?,22?,23+,24-/m1/s1 |
| InChIKey | TYTLNXWDRBIRHM-HIALMCOXSA-N |
| XLogP | 5.46 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|