About 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine
1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 70954634) has the molecular formula C14H23NO2S
and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine |
| PubChem CID | 70954634 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | CCN1CCC(C2=CC=CC(S(C)(=O)=O)C2)CC1 |
| InChI | InChI=1S/C14H23NO2S/c1-3-15-9-7-12(8-10-15)13-5-4-6-14(11-13)18(2,16)17/h4-6,12,14H,3,7-11H2,1-2H3 |
| InChIKey | UYWMKXQYKUQENU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine?
The IUPAC name of 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine (CID 70954634) is 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine.
What is the SMILES notation for 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine?
The canonical SMILES for 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine is CCN1CCC(C2=CC=CC(S(C)(=O)=O)C2)CC1.
What is the InChIKey of 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine?
The InChIKey is UYWMKXQYKUQENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2S/c1-3-15-9-7-12(8-10-15)13-5-4-6-14(11-13)18(2,16)17/h4-6,12,14H,3,7-11H2,1-2H3.
What are the key properties of 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine?
1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine has a molecular weight of 269.41 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(5-methylsulfonylcyclohexa-1,3-dien-1-yl)piperidine is sourced from PubChem (CID 70954634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).