C10H15NO5 — CID 70954645
1-(1,3-dihydroxy-2-methoxypentan-3-yl)pyrrole-2,5-dione (PubChem CID 70954645) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-2-methoxypentan-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-(1,3-dihydroxy-2-methoxypentan-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70954645 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-(1,3-dihydroxy-2-methoxypentan-3-yl)pyrrole-2,5-dione |
| SMILES | CCC(O)(C(CO)OC)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H15NO5/c1-3-10(15,7(6-12)16-2)11-8(13)4-5-9(11)14/h4-5,7,12,15H,3,6H2,1-2H3 |
| InChIKey | WYFOVZVYYUZZGS-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|