C29H32F3N3O2 — CID 70954661
1-[(4-acetylphenyl)methyl]-N-(4-tert-butylcyclohexyl)-3-(3,4,5-trifluorophenyl)pyrazole-5-carboxamide (PubChem CID 70954661) has the molecular formula C29H32F3N3O2 and a molecular weight of 511.59 g/mol. Its IUPAC name is 1-[(4-acetylphenyl)methyl]-N-(4-tert-butylcyclohexyl)-3-(3,4,5-trifluorophenyl)pyrazole-5-carboxamide.
| Compound Name | 1-[(4-acetylphenyl)methyl]-N-(4-tert-butylcyclohexyl)-3-(3,4,5-trifluorophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 70954661 |
| Molecular Formula | C29H32F3N3O2 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-[(4-acetylphenyl)methyl]-N-(4-tert-butylcyclohexyl)-3-(3,4,5-trifluorophenyl)pyrazole-5-carboxamide |
| SMILES | CC(=O)c1ccc(Cn2nc(-c3cc(F)c(F)c(F)c3)cc2C(=O)NC2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H32F3N3O2/c1-17(36)19-7-5-18(6-8-19)16-35-26(15-25(34-35)20-13-23(30)27(32)24(31)14-20)28(37)33-22-11-9-21(10-12-22)29(2,3)4/h5-8,13-15,21-22H,9-12,16H2,1-4H3,(H,33,37) |
| InChIKey | FEXNQCAJGURJGR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|