C17H16Cl2N2O — CID 70955707
(1R,7R)-4-(2,5-dichlorophenyl)-3,8-dimethyl-3,4-diazatetracyclo[5.2.2.01,8.02,6]undec-2(6)-en-5-one (PubChem CID 70955707) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is (1R,7R)-4-(2,5-dichlorophenyl)-3,8-dimethyl-3,4-diazatetracyclo[5.2.2.01,8.02,6]undec-2(6)-en-5-one.
| Compound Name | (1R,7R)-4-(2,5-dichlorophenyl)-3,8-dimethyl-3,4-diazatetracyclo[5.2.2.01,8.02,6]undec-2(6)-en-5-one |
|---|---|
| PubChem CID | 70955707 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (1R,7R)-4-(2,5-dichlorophenyl)-3,8-dimethyl-3,4-diazatetracyclo[5.2.2.01,8.02,6]undec-2(6)-en-5-one |
| SMILES | Cn1c2c(c(=O)n1-c1cc(Cl)ccc1Cl)[C@@H]1CC[C@]23CC13C |
| InChI | InChI=1S/C17H16Cl2N2O/c1-16-8-17(16)6-5-10(16)13-14(17)20(2)21(15(13)22)12-7-9(18)3-4-11(12)19/h3-4,7,10H,5-6,8H2,1-2H3/t10-,16?,17-/m0/s1 |
| InChIKey | ZEPJUAWEZPBQJS-QOWIBRAASA-N |
| XLogP | 4.02 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |