C22H27ClN2O4 — CID 70956003
2-[4-[3-[4-chloro-2-(4-methylpiperazin-1-yl)phenoxy]propoxy]phenyl]acetic acid (PubChem CID 70956003) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-[4-[3-[4-chloro-2-(4-methylpiperazin-1-yl)phenoxy]propoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[3-[4-chloro-2-(4-methylpiperazin-1-yl)phenoxy]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 70956003 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[4-[3-[4-chloro-2-(4-methylpiperazin-1-yl)phenoxy]propoxy]phenyl]acetic acid |
| SMILES | CN1CCN(c2cc(Cl)ccc2OCCCOc2ccc(CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C22H27ClN2O4/c1-24-9-11-25(12-10-24)20-16-18(23)5-8-21(20)29-14-2-13-28-19-6-3-17(4-7-19)15-22(26)27/h3-8,16H,2,9-15H2,1H3,(H,26,27) |
| InChIKey | UCUXROMJMKTLRG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|