C21H14FN3O2 — CID 70957308
(4R,5R)-5-(4-fluorophenyl)-4-[5-(2-pyridin-2-ylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one (PubChem CID 70957308) has the molecular formula C21H14FN3O2 and a molecular weight of 359.36 g/mol. Its IUPAC name is (4R,5R)-5-(4-fluorophenyl)-4-[5-(2-pyridin-2-ylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-5-(4-fluorophenyl)-4-[5-(2-pyridin-2-ylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70957308 |
| Molecular Formula | C21H14FN3O2 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (4R,5R)-5-(4-fluorophenyl)-4-[5-(2-pyridin-2-ylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2cncc(C#Cc3ccccn3)c2)[C@@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C21H14FN3O2/c22-17-7-5-15(6-8-17)20-19(25-21(26)27-20)16-11-14(12-23-13-16)4-9-18-3-1-2-10-24-18/h1-3,5-8,10-13,19-20H,(H,25,26)/t19-,20-/m1/s1 |
| InChIKey | BQEDZOWUAYSDQU-WOJBJXKFSA-N |
| XLogP | 3.54 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|