About 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate
2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate (PubChem CID 70957544) has the molecular formula C24H35FN2O3
and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate |
| PubChem CID | 70957544 |
| Molecular Formula | C24H35FN2O3 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate |
| SMILES | CC(C)COC(=O)NC1CCCCC(N2CCC3(CC2)COc2ccc(F)cc23)C1 |
| InChI | InChI=1S/C24H35FN2O3/c1-17(2)15-29-23(28)26-19-5-3-4-6-20(14-19)27-11-9-24(10-12-27)16-30-22-8-7-18(25)13-21(22)24/h7-8,13,17,19-20H,3-6,9-12,14-16H2,1-2H3,(H,26,28) |
| InChIKey | XXYOWXQTRIWYSU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate?
The IUPAC name of 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate (CID 70957544) is 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate?
The canonical SMILES for 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate is CC(C)COC(=O)NC1CCCCC(N2CCC3(CC2)COc2ccc(F)cc23)C1.
What is the InChIKey of 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate?
The InChIKey is XXYOWXQTRIWYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35FN2O3/c1-17(2)15-29-23(28)26-19-5-3-4-6-20(14-19)27-11-9-24(10-12-27)16-30-22-8-7-18(25)13-21(22)24/h7-8,13,17,19-20H,3-6,9-12,14-16H2,1-2H3,(H,26,28).
What are the key properties of 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate?
2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate has a molecular weight of 418.55 g/mol, XLogP of 4.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)cycloheptyl]carbamate is sourced from PubChem (CID 70957544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).