C16H7FN2S2 — CID 70957910
16-fluoro-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1,3,6,9,11,13,15,17,19-nonaene (PubChem CID 70957910) has the molecular formula C16H7FN2S2 and a molecular weight of 310.38 g/mol. Its IUPAC name is 16-fluoro-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1,3,6,9,11,13,15,17,19-nonaene.
| Compound Name | 16-fluoro-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1,3,6,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 70957910 |
| Molecular Formula | C16H7FN2S2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 16-fluoro-5,8-dithia-13,20-diazapentacyclo[10.8.0.02,6.07,11.014,19]icosa-1,3,6,9,11,13,15,17,19-nonaene |
| SMILES | Fc1ccc2nc3c4ccsc4c4sccc4c3nc2c1 |
| InChI | InChI=1S/C16H7FN2S2/c17-8-1-2-11-12(7-8)19-14-10-4-6-21-16(10)15-9(3-5-20-15)13(14)18-11/h1-7H |
| InChIKey | OFIOGAKFFLPPJQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|