C10H17IO — CID 70957927
2-iodo-4,4,6,6-tetramethylcyclohex-2-en-1-ol (PubChem CID 70957927) has the molecular formula C10H17IO and a molecular weight of 280.15 g/mol. Its IUPAC name is 2-iodo-4,4,6,6-tetramethylcyclohex-2-en-1-ol.
| Compound Name | 2-iodo-4,4,6,6-tetramethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 70957927 |
| Molecular Formula | C10H17IO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-iodo-4,4,6,6-tetramethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)C=C(I)C(O)C(C)(C)C1 |
| InChI | InChI=1S/C10H17IO/c1-9(2)5-7(11)8(12)10(3,4)6-9/h5,8,12H,6H2,1-4H3 |
| InChIKey | AJQRRWFWHABPRP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|