C19H32O4 — CID 70957971
spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ylmethyl 2,2-dimethylbutanoate (PubChem CID 70957971) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ylmethyl 2,2-dimethylbutanoate.
| Compound Name | spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70957971 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-ylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC2OC3(CCCCC3)OC2C1 |
| InChI | InChI=1S/C19H32O4/c1-4-18(2,3)17(20)21-13-14-8-9-15-16(12-14)23-19(22-15)10-6-5-7-11-19/h14-16H,4-13H2,1-3H3 |
| InChIKey | ZBGFUHVYRIIARC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |