C12H24N4O2 — CID 70958043
N-(3-hydrazinyl-3-oxopropyl)-2-[(2R,6S)-2-methyl-6-(113C)methyl(2,6-13C2,115N)azinan-1-yl]acetamide (PubChem CID 70958043) has the molecular formula C12H24N4O2 and a molecular weight of 260.32 g/mol. Its IUPAC name is N-(3-hydrazinyl-3-oxopropyl)-2-[(2R,6S)-2-methyl-6-(113C)methyl(2,6-13C2,115N)azinan-1-yl]acetamide.
| Compound Name | N-(3-hydrazinyl-3-oxopropyl)-2-[(2R,6S)-2-methyl-6-(113C)methyl(2,6-13C2,115N)azinan-1-yl]acetamide |
|---|---|
| PubChem CID | 70958043 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | N-(3-hydrazinyl-3-oxopropyl)-2-[(2R,6S)-2-methyl-6-(113C)methyl(2,6-13C2,115N)azinan-1-yl]acetamide |
| SMILES | C[13C@@H]1CCC[13C@H]([13CH3])[15N]1CC(=O)NCCC(=O)NN |
| InChI | InChI=1S/C12H24N4O2/c1-9-4-3-5-10(2)16(9)8-12(18)14-7-6-11(17)15-13/h9-10H,3-8,13H2,1-2H3,(H,14,18)(H,15,17)/t9-,10+/i1+1,9+1,10+1,16+1/m0/s1 |
| InChIKey | XFKFYJUHKLOJOE-JJWTWEEKSA-N |
| XLogP | -0.25 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|