C18H32O4 — CID 70958102
(2-methyl-2-propyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate (PubChem CID 70958102) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (2-methyl-2-propyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate.
| Compound Name | (2-methyl-2-propyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70958102 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (2-methyl-2-propyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate |
| SMILES | CCCC1(C)OC2CCC(COC(=O)C(C)(C)CC)CC2O1 |
| InChI | InChI=1S/C18H32O4/c1-6-10-18(5)21-14-9-8-13(11-15(14)22-18)12-20-16(19)17(3,4)7-2/h13-15H,6-12H2,1-5H3 |
| InChIKey | KLXXUSPDWMIGCW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |