C16H28O4 — CID 70958166
(2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate (PubChem CID 70958166) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate.
| Compound Name | (2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70958166 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC2OC(C)(C)OC2C1 |
| InChI | InChI=1S/C16H28O4/c1-6-15(2,3)14(17)18-10-11-7-8-12-13(9-11)20-16(4,5)19-12/h11-13H,6-10H2,1-5H3 |
| InChIKey | OPUWDFDTQRHTQX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |