C27H33NO2 — CID 70958202
(3S,10R,13R)-13-(hydroxymethyl)-17-indol-1-yl-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 70958202) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (3S,10R,13R)-13-(hydroxymethyl)-17-indol-1-yl-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13R)-13-(hydroxymethyl)-17-indol-1-yl-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70958202 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (3S,10R,13R)-13-(hydroxymethyl)-17-indol-1-yl-10-methyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CCC1C3CC=C(n4ccc5ccccc54)[C@@]3(CO)CCC12 |
| InChI | InChI=1S/C27H33NO2/c1-26-13-10-20(30)16-19(26)6-7-21-22(26)11-14-27(17-29)23(21)8-9-25(27)28-15-12-18-4-2-3-5-24(18)28/h2-6,9,12,15,20-23,29-30H,7-8,10-11,13-14,16-17H2,1H3/t20-,21?,22?,23?,26-,27+/m0/s1 |
| InChIKey | SKVAEAFNYNRMAT-QIIBKTQHSA-N |
| XLogP | 5.39 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|