C20H28O4 — CID 70958225
(2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate (PubChem CID 70958225) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate.
| Compound Name | (2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70958225 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC2OC(c3ccccc3)OC2C1 |
| InChI | InChI=1S/C20H28O4/c1-4-20(2,3)19(21)22-13-14-10-11-16-17(12-14)24-18(23-16)15-8-6-5-7-9-15/h5-9,14,16-18H,4,10-13H2,1-3H3 |
| InChIKey | OQQRKQJVHJYYHK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |