C25H32N4O10 — CID 70958656
4,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]heptanedioic acid (PubChem CID 70958656) has the molecular formula C25H32N4O10 and a molecular weight of 548.55 g/mol. Its IUPAC name is 4,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]heptanedioic acid.
| Compound Name | 4,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]heptanedioic acid |
|---|---|
| PubChem CID | 70958656 |
| Molecular Formula | C25H32N4O10 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 4,4-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]heptanedioic acid |
| SMILES | O=C(O)CCC(CCNC(=O)CCN1C(=O)C=CC1=O)(CCNC(=O)CCN1C(=O)C=CC1=O)CCC(=O)O |
| InChI | InChI=1S/C25H32N4O10/c30-17(7-15-28-19(32)1-2-20(28)33)26-13-11-25(9-5-23(36)37,10-6-24(38)39)12-14-27-18(31)8-16-29-21(34)3-4-22(29)35/h1-4H,5-16H2,(H,26,30)(H,27,31)(H,36,37)(H,38,39) |
| InChIKey | MONGIDVDTQPILR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|