C26H40O3 — CID 70958698
(3S,8S,9S,10R,13S,14S)-17-[(2R)-1-(1,3-dioxolan-2-yl)propan-2-yl]-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 70958698) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S)-17-[(2R)-1-(1,3-dioxolan-2-yl)propan-2-yl]-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (3S,8S,9S,10R,13S,14S)-17-[(2R)-1-(1,3-dioxolan-2-yl)propan-2-yl]-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 70958698 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S)-17-[(2R)-1-(1,3-dioxolan-2-yl)propan-2-yl]-3,10,13-trimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C([C@H](C)CC4OCCO4)C(=O)C[C@@H]32)C1 |
| InChI | InChI=1S/C26H40O3/c1-16-7-9-25(3)18(13-16)5-6-19-20(25)8-10-26(4)21(19)15-22(27)24(26)17(2)14-23-28-11-12-29-23/h5,16-17,19-21,23-24H,6-15H2,1-4H3/t16-,17+,19+,20-,21-,24?,25-,26-/m0/s1 |
| InChIKey | NSGUGLIAQJNTFQ-IVXPESRYSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|