C43H49N3O10 — CID 70959161
2-[3-(hydroxymethyl)-4-[8-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]octoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 70959161) has the molecular formula C43H49N3O10 and a molecular weight of 767.88 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-4-[8-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]octoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[3-(hydroxymethyl)-4-[8-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]octoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 70959161 |
| Molecular Formula | C43H49N3O10 |
| Molecular Weight | 767.88 g/mol |
| Exact Mass | 767.34 |
| IUPAC Name | 2-[3-(hydroxymethyl)-4-[8-[2-methoxy-5-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]octoxy]phenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCCCCCCCOc3cc(-c4cc(-c5cc(CO)c(CO)c(CO)c5)no4)ccc3OC)c(CO)c1)N2 |
| InChI | InChI=1S/C43H49N3O10/c1-52-33-11-12-36-34(21-33)43(51)45-42(44-36)28-10-13-38(32(17-28)25-49)54-15-7-5-3-4-6-8-16-55-41-20-27(9-14-39(41)53-2)40-22-37(46-56-40)29-18-30(23-47)35(26-50)31(19-29)24-48/h9-14,17-22,42,44,47-50H,3-8,15-16,23-26H2,1-2H3,(H,45,51) |
| InChIKey | VLKBKQWYZIQGFG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.88 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|