C46H55N3O10 — CID 70959187
2-[4-[10-[2,6-dimethoxy-4-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]decoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 70959187) has the molecular formula C46H55N3O10 and a molecular weight of 809.96 g/mol. Its IUPAC name is 2-[4-[10-[2,6-dimethoxy-4-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]decoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[10-[2,6-dimethoxy-4-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]decoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 70959187 |
| Molecular Formula | C46H55N3O10 |
| Molecular Weight | 809.96 g/mol |
| Exact Mass | 809.39 |
| IUPAC Name | 2-[4-[10-[2,6-dimethoxy-4-[3-[3,4,5-tris(hydroxymethyl)phenyl]-1,2-oxazol-5-yl]phenoxy]decoxy]-3-(hydroxymethyl)phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(-c2cc(-c3cc(CO)c(CO)c(CO)c3)no2)cc(OC)c1OCCCCCCCCCCOc1ccc(C2NC(=O)c3cc(C)ccc3N2)cc1CO |
| InChI | InChI=1S/C46H55N3O10/c1-29-12-14-38-36(18-29)46(54)48-45(47-38)30-13-15-40(35(19-30)27-52)57-16-10-8-6-4-5-7-9-11-17-58-44-42(55-2)22-32(23-43(44)56-3)41-24-39(49-59-41)31-20-33(25-50)37(28-53)34(21-31)26-51/h12-15,18-24,45,47,50-53H,4-11,16-17,25-28H2,1-3H3,(H,48,54) |
| InChIKey | CLSOIBYXHGNVMU-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.96 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|