C24H33N3O4 — CID 70959223
2-methoxyethyl 6-(2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate (PubChem CID 70959223) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-methoxyethyl 6-(2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate.
| Compound Name | 2-methoxyethyl 6-(2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 70959223 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-methoxyethyl 6-(2-oxospiro[1H-indole-3,4'-piperidine]-1'-yl)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate |
| SMILES | COCCOC(=O)N1CCCC2CC(N3CCC4(CC3)C(=O)Nc3ccccc34)CC21 |
| InChI | InChI=1S/C24H33N3O4/c1-30-13-14-31-23(29)27-10-4-5-17-15-18(16-21(17)27)26-11-8-24(9-12-26)19-6-2-3-7-20(19)25-22(24)28/h2-3,6-7,17-18,21H,4-5,8-16H2,1H3,(H,25,28) |
| InChIKey | QYRJEKKHVHNLEU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|