C22H31N — CID 70959400
1'-[(2S)-2-[(1R)-cyclopent-2-en-1-yl]butyl]spiro[1,2-dihydroindene-3,4'-piperidine] (PubChem CID 70959400) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 1'-[(2S)-2-[(1R)-cyclopent-2-en-1-yl]butyl]spiro[1,2-dihydroindene-3,4'-piperidine].
| Compound Name | 1'-[(2S)-2-[(1R)-cyclopent-2-en-1-yl]butyl]spiro[1,2-dihydroindene-3,4'-piperidine] |
|---|---|
| PubChem CID | 70959400 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 1'-[(2S)-2-[(1R)-cyclopent-2-en-1-yl]butyl]spiro[1,2-dihydroindene-3,4'-piperidine] |
| SMILES | CC[C@H](CN1CCC2(CCc3ccccc32)CC1)[C@H]1C=CCC1 |
| InChI | InChI=1S/C22H31N/c1-2-18(19-7-3-4-8-19)17-23-15-13-22(14-16-23)12-11-20-9-5-6-10-21(20)22/h3,5-7,9-10,18-19H,2,4,8,11-17H2,1H3/t18-,19+/m1/s1 |
| InChIKey | HFWOHMGBZOKPGI-MOPGFXCFSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|