C25H35FN4O3 — CID 70959438
methyl 6-[1-(dimethylcarbamoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate (PubChem CID 70959438) has the molecular formula C25H35FN4O3 and a molecular weight of 458.58 g/mol. Its IUPAC name is methyl 6-[1-(dimethylcarbamoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate.
| Compound Name | methyl 6-[1-(dimethylcarbamoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 70959438 |
| Molecular Formula | C25H35FN4O3 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | methyl 6-[1-(dimethylcarbamoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate |
| SMILES | COC(=O)N1CCCC2CC(N3CCC4(CC3)CN(C(=O)N(C)C)c3ccc(F)cc34)CC21 |
| InChI | InChI=1S/C25H35FN4O3/c1-27(2)23(31)30-16-25(20-14-18(26)6-7-21(20)30)8-11-28(12-9-25)19-13-17-5-4-10-29(22(17)15-19)24(32)33-3/h6-7,14,17,19,22H,4-5,8-13,15-16H2,1-3H3 |
| InChIKey | SMFIGOSESUOJLX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |