C24H43N5O4S — CID 70960235
7-[2-butoxy-1-[(2R)-1,3-dibutoxybutan-2-yl]oxyethyl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 70960235) has the molecular formula C24H43N5O4S and a molecular weight of 497.71 g/mol. Its IUPAC name is 7-[2-butoxy-1-[(2R)-1,3-dibutoxybutan-2-yl]oxyethyl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[2-butoxy-1-[(2R)-1,3-dibutoxybutan-2-yl]oxyethyl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 70960235 |
| Molecular Formula | C24H43N5O4S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 7-[2-butoxy-1-[(2R)-1,3-dibutoxybutan-2-yl]oxyethyl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCOCC(O[C@H](COCCCC)C(C)OCCCC)c1cnc2c(N)nc(SC)nn12 |
| InChI | InChI=1S/C24H43N5O4S/c1-6-9-12-30-16-20(18(4)32-14-11-8-3)33-21(17-31-13-10-7-2)19-15-26-23-22(25)27-24(34-5)28-29(19)23/h15,18,20-21H,6-14,16-17H2,1-5H3,(H2,25,27,28)/t18?,20-,21?/m1/s1 |
| InChIKey | IHOLFSHNXUWOMQ-VEDCXYSMSA-N |
| XLogP | 4.69 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|