C33H36FN3O — CID 70960507
(2S)-3'-[4-(4-fluorophenyl)piperidin-1-yl]-1-methyl-7-pyridin-2-ylspiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one (PubChem CID 70960507) has the molecular formula C33H36FN3O and a molecular weight of 509.67 g/mol. Its IUPAC name is (2S)-3'-[4-(4-fluorophenyl)piperidin-1-yl]-1-methyl-7-pyridin-2-ylspiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one.
| Compound Name | (2S)-3'-[4-(4-fluorophenyl)piperidin-1-yl]-1-methyl-7-pyridin-2-ylspiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 70960507 |
| Molecular Formula | C33H36FN3O |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (2S)-3'-[4-(4-fluorophenyl)piperidin-1-yl]-1-methyl-7-pyridin-2-ylspiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
| SMILES | CC1C2Cc3ccc(-c4ccccn4)cc3CN2C(=O)[C@]12CCC(N1CCC(c3ccc(F)cc3)CC1)C2 |
| InChI | InChI=1S/C33H36FN3O/c1-22-31-19-25-5-6-26(30-4-2-3-15-35-30)18-27(25)21-37(31)32(38)33(22)14-11-29(20-33)36-16-12-24(13-17-36)23-7-9-28(34)10-8-23/h2-10,15,18,22,24,29,31H,11-14,16-17,19-21H2,1H3/t22?,29?,31?,33-/m0/s1 |
| InChIKey | WBHSQTLHQWGLLH-XTGSCBPPSA-N |
| XLogP | 6.21 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |