About 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene
5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene (PubChem CID 70961035) has the molecular formula C15H19FO
and a molecular weight of 234.31 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene |
| PubChem CID | 70961035 |
| Molecular Formula | C15H19FO |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene |
| SMILES | COCC1=C(F)CC(C2=CC=CCC2)C(C)=C1 |
| InChI | InChI=1S/C15H19FO/c1-11-8-13(10-17-2)15(16)9-14(11)12-6-4-3-5-7-12/h3-4,6,8,14H,5,7,9-10H2,1-2H3 |
| InChIKey | DMIZBXQCCMHCQR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene?
The IUPAC name of 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene (CID 70961035) is 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene.
What is the SMILES notation for 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene?
The canonical SMILES for 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene is COCC1=C(F)CC(C2=CC=CCC2)C(C)=C1.
What is the InChIKey of 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene?
The InChIKey is DMIZBXQCCMHCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO/c1-11-8-13(10-17-2)15(16)9-14(11)12-6-4-3-5-7-12/h3-4,6,8,14H,5,7,9-10H2,1-2H3.
What are the key properties of 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene?
5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene has a molecular weight of 234.31 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,3-dien-1-yl-1-fluoro-2-(methoxymethyl)-4-methylcyclohexa-1,3-diene is sourced from PubChem (CID 70961035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).